64323-57-5 Usage
Type of compound
Heterocyclic compound
Structure
Cyclic organic compound containing six nitrogen atoms and four carbon atoms arranged in a six-membered ring
Potential applications
Coordination chemistry
Function
Can serve as a ligand for metal ions
Metal ions studied
Copper, cobalt, and nickel
Potential uses
Catalysis and synthesis of coordination polymers
Fields of interest
Organic chemistry and materials science
Unique properties
Structural and electronic properties
Check Digit Verification of cas no
The CAS Registry Mumber 64323-57-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,3,2 and 3 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 64323-57:
(7*6)+(6*4)+(5*3)+(4*2)+(3*3)+(2*5)+(1*7)=115
115 % 10 = 5
So 64323-57-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H4N6/c1-5-9-3-11-7-12-4-10-6(2-8-1)13(5)7/h1-4H
