6439-91-4 Usage
Uses
Used in Pharmaceutical Industry:
5-BROMO-1,2,3-THIADIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is used as an intermediate in the synthesis of fused 1,3,6-thiadiazepines, which are a class of compounds with potential biological activities. These fused thiadiazepines, such as di[1,2,3]triazolo[1,5-a:5',1'-d][3,1,5]benzothiadiazepines, may exhibit therapeutic properties and can be further explored for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, 5-BROMO-1,2,3-THIADIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER can be utilized as a building block for the creation of novel compounds with diverse applications. Its unique structure allows for the exploration of new chemical reactions and the synthesis of innovative materials with potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6439-91-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,3 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6439-91:
(6*6)+(5*4)+(4*3)+(3*9)+(2*9)+(1*1)=114
114 % 10 = 4
So 6439-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN2O2S/c1-2-10-5(9)3-4(6)11-8-7-3/h2H2,1H3
