64398-72-7 Usage
Uses
Used in Pharmaceutical Industry:
(2S)-2-acetamido-5-(diaminomethylideneamino)-3-hydroxy-pentanoic acid is used as a key intermediate for the biosynthesis of L-lysine, which is essential for human nutrition and health. Its role in the production of antibiotics and antifungal agents makes it a valuable component in the development of new medications to combat various diseases.
Used in Biotechnology Industry:
In the field of biotechnology, (2S)-2-acetamido-5-(diaminomethylideneamino)-3-hydroxy-pentanoic acid is utilized for its potential applications in enhancing metabolic pathways and contributing to the development of novel biological processes and products.
Used in Drug Development:
(2S)-2-acetamido-5-(diaminomethylideneamino)-3-hydroxy-pentanoic acid serves as a target for drug discovery research, where its unique biochemical properties and involvement in essential metabolic processes can be leveraged to create new therapeutic agents and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 64398-72-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,3,9 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 64398-72:
(7*6)+(6*4)+(5*3)+(4*9)+(3*8)+(2*7)+(1*2)=157
157 % 10 = 7
So 64398-72-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N4O4/c1-4(13)12-6(7(15)16)5(14)2-3-11-8(9)10/h5-6,14H,2-3H2,1H3,(H,12,13)(H,15,16)(H4,9,10,11)/t5?,6-/m0/s1
