64407-99-4 Usage
General Description
L-Glutamic acid magnesium salt trihydrate is a compound consisting of the amino acid L-glutamic acid bound to magnesium ions with three molecules of water. It is commonly used as a dietary supplement due to its role in protein synthesis and neurotransmitter function. Additionally, magnesium is an essential mineral that plays a key role in various physiological processes, including muscle function, nerve function, and bone health. The trihydrate form of this compound indicates that it contains three molecules of water per molecule of L-glutamic acid magnesium salt, which can affect the compound's solubility and stability. Overall, L-glutamic acid magnesium salt trihydrate is a versatile chemical with various potential applications in the pharmaceutical and nutrition industries.
Check Digit Verification of cas no
The CAS Registry Mumber 64407-99-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,4,0 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 64407-99:
(7*6)+(6*4)+(5*4)+(4*0)+(3*7)+(2*9)+(1*9)=134
134 % 10 = 4
So 64407-99-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO4.Mg.2H/c6-3(5(9)10)1-2-4(7)8;;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;;/p-2/t3-;;;/m0.../s1/rC5H9NO4.H2Mg/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2/p-2/t3-;/m0./s1