64488-03-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(3,4-DICHLOROBENZYL)-2-OXO-1,2-DIHYDRO-3-PYRIDINECARBOXYLIC ACID is used as a building block in the synthesis of various pharmaceuticals for its potential applications in drug development. Its unique molecular structure and functional groups allow for the creation of diverse compounds with potential therapeutic effects.
Used in Organic Chemistry:
In the field of organic chemistry, 1-(3,4-DICHLOROBENZYL)-2-OXO-1,2-DIHYDRO-3-PYRIDINECARBOXYLIC ACID is utilized as a versatile intermediate. Its molecular structure and functional groups enable chemists to synthesize a wide range of compounds with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 64488-03-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,4,8 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 64488-03:
(7*6)+(6*4)+(5*4)+(4*8)+(3*8)+(2*0)+(1*3)=145
145 % 10 = 5
So 64488-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H9Cl2NO3/c14-10-4-3-8(6-11(10)15)7-16-5-1-2-9(12(16)17)13(18)19/h1-6H,7H2,(H,18,19)
