64497-95-6 Usage
General Description
1-(1-benzyl-5-methyl-4H-pyridin-3-yl)ethanone is a chemical compound with the molecular formula C16H17NO. It is a substituted pyridine derivative, which contains a benzyl group and a methyl group attached to the pyridine ring. 1-(1-benzyl-5-methyl-4H-pyridin-3-yl)ethanone is commonly used in the pharmaceutical and research industries as a building block for the synthesis of various pharmaceutical drugs and organic compounds. Its structural features make it a versatile precursor for the development of new drugs and potentially biologically active molecules. Additionally, it is also used as a reagent in organic synthesis and chemical research. Overall, 1-(1-benzyl-5-methyl-4H-pyridin-3-yl)ethanone has a wide range of potential applications in the field of medicinal and organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 64497-95-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,4,9 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 64497-95:
(7*6)+(6*4)+(5*4)+(4*9)+(3*7)+(2*9)+(1*5)=166
166 % 10 = 6
So 64497-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO/c1-12-8-15(13(2)17)11-16(9-12)10-14-6-4-3-5-7-14/h3-7,9,11H,8,10H2,1-2H3