64574-24-9 Usage
Uses
Used in Pharmaceutical Research:
(1H-benzo[d]imidazol-7-yl)methanamine is used as a building block for the synthesis of various biologically active compounds, contributing to the development of new drugs with potential therapeutic applications.
Used in Anti-cancer Applications:
(1H-benzo[d]imidazol-7-yl)methanamine is used as an anti-cancer agent for its inhibitory effects on protein kinases, which play a crucial role in the regulation of cell growth and division. Its potential in targeting specific kinases makes it a promising candidate for cancer treatment.
Used in Neurological Disorders Treatment:
(1H-benzo[d]imidazol-7-yl)methanamine is used as a potential therapeutic agent for the treatment of neurological disorders, given its ability to modulate specific signaling pathways involved in these conditions.
Used in Anti-inflammatory Applications:
(1H-benzo[d]imidazol-7-yl)methanamine is used as an anti-inflammatory agent, leveraging its potential to regulate inflammatory processes and alleviate symptoms associated with inflammatory diseases.
Used in Medicinal Chemistry and Drug Discovery:
(1H-benzo[d]imidazol-7-yl)methanamine is used as a valuable compound in the field of medicinal chemistry and drug discovery, due to its diverse pharmacological properties and potential for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 64574-24-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,5,7 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 64574-24:
(7*6)+(6*4)+(5*5)+(4*7)+(3*4)+(2*2)+(1*4)=139
139 % 10 = 9
So 64574-24-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3/c9-4-6-2-1-3-7-8(6)11-5-10-7/h1-3,5H,4,9H2,(H,10,11)
