6459-79-6

Usage

Uses

Used in Pharmaceutical Industry:
Triisopropylsilane is used as a reducing agent for the synthesis of complex organic molecules, facilitating the development of new pharmaceutical compounds. Its ability to selectively reduce functional groups without affecting other parts of the molecule makes it an indispensable tool in drug discovery and synthesis.
Used in Fine Chemical Industry:
In the fine chemical industry, Triisopropylsilane is employed as a reagent in silicon-based chemistry, enabling the production of high-purity specialty chemicals. Its use as a stabilizer and protective agent for sensitive compounds ensures the integrity and quality of these chemicals during manufacturing processes.
Used in Agrochemical Industry:
Triisopropylsilane is utilized in the agrochemical industry for the synthesis of various agrochemicals, including pesticides and herbicides. Its reducing capabilities allow for the efficient production of these compounds, contributing to the development of effective and sustainable agricultural solutions.
Used as a Reducing Agent in Organic Synthesis:
Triisopropylsilane is used as a reducing agent for the selective reduction of functional groups in organic synthesis. Its efficiency in reducing carbonyl compounds, nitro groups, and double bonds makes it a preferred choice for chemists working on complex organic transformations.
Used as a Stabilizer and Protective Agent:
Triisopropylsilane serves as a stabilizer and protective agent for sensitive compounds, ensuring their stability and preventing unwanted side reactions during synthesis. This role is crucial in maintaining the purity and yield of the final product in various chemical processes.

InChI:InChI=1/C9H22Si/c1-7(2)10(8(3)4)9(5)6/h7-10H,1-6H3