6466-22-4 Usage
Molecular structure
A complex chemical compound with a unique molecular structure, consisting of a purine-based core with methyl and hexylthio groups attached.
Functional groups
Contains both methyl (-CH3) and hexylthio (-S-(CH2)5CH3) groups, which contribute to its chemical properties and reactivity.
Dithione groups
Presence of two dithione (-C(=S)-S-) groups in the molecule, which adds to its reactivity and potential applications.
Purine-based compound
Derived from the purine family of compounds, which are important in biochemistry and are found in nucleic acids and some coenzymes.
Potential applications
Has potential uses in the pharmaceutical industry, as a possible drug target or therapeutic agent.
Biological activities
Its unique molecular structure and potential biological activities make it an interesting target for further research and potential applications in various fields.
Research interest
Due to its complex structure and potential applications, 1,3-Dimethyl-8-(hexylthio)-1H-purine-2,6(3H,7H)-dithione is a subject of interest for scientists and researchers in the fields of chemistry, biochemistry, and pharmacology.
Synthesis
The synthesis of 1,3-Dimethyl-8-(hexylthio)-1H-purine-2,6(3H,7H)-dithione may involve multiple steps and require specific reagents and conditions to form the desired product.
Stability
The stability of 1,3-Dimethyl-8-(hexylthio)-1H-purine-2,6(3H,7H)-dithione under various conditions (e.g., temperature, pH, etc.) may be a factor to consider for its potential applications and storage.
Solubility
The solubility of 1,3-Dimethyl-8-(hexylthio)-1H-purine-2,6(3H,7H)-dithione in different solvents (e.g., water, organic solvents) may affect its formulation and administration in potential pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6466-22-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,6 and 6 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6466-22:
(6*6)+(5*4)+(4*6)+(3*6)+(2*2)+(1*2)=104
104 % 10 = 4
So 6466-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H20N4S3/c1-4-5-6-7-8-20-12-14-9-10(15-12)16(2)13(19)17(3)11(9)18/h4-8H2,1-3H3,(H,14,15)
