6466-23-5 Usage
Chemical class
Purine derivatives
It belongs to a class of compounds derived from purine, which is a key component of nucleic acids.
Molecular structure
Purine ring with dithione and heptylthio group
The compound features a purine ring, which is a fused six-membered and five-membered nitrogen-containing ring, with a dithione group (two sulfur atoms bonded to two oxygen atoms) and a heptylthio group (a seven-carbon alkyl chain with a sulfur atom attached) attached to the molecule.
Potential applications
Pharmacology and medicinal chemistry
Due to its unique molecular structure and properties, the compound may have biological activities and therapeutic potential that could be further explored for drug development.
Biological activities
Unknown, but may be explored for drug development
The specific biological activities of the compound are not provided, but its unique structure suggests that it could have potential applications in the field of drug development.
Chemical reactivity
Valuable for research and synthetic chemistry
The compound's chemical structure and reactivity make it a valuable molecule for research and synthetic chemistry, potentially leading to the development of new compounds with desired properties.
Stability
Unknown, but may depend on environmental factors
The stability of the compound is not provided, but it may be influenced by factors such as temperature, pH, and the presence of other chemicals.
Solubility
Unknown, but may vary depending on the solvent
The solubility of the compound is not provided, but it may vary depending on the solvent used and the compound's polarity.
Toxicity
Unknown, but should be considered in research and development
The toxicity of the compound is not provided, but it is an important factor to consider when exploring its potential applications in pharmacology and medicinal chemistry.
Synthesis
Complex, involving multiple steps and chemical reactions
The synthesis of 1,3-Dimethyl-8-(heptylthio)-1H-purine-2,6(3H,7H)-dithione is likely to be complex, involving multiple steps and chemical reactions to form the desired molecular structure.
Check Digit Verification of cas no
The CAS Registry Mumber 6466-23-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,6 and 6 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6466-23:
(6*6)+(5*4)+(4*6)+(3*6)+(2*2)+(1*3)=105
105 % 10 = 5
So 6466-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H22N4S3/c1-4-5-6-7-8-9-21-13-15-10-11(16-13)17(2)14(20)18(3)12(10)19/h4-9H2,1-3H3,(H,15,16)
