64689-22-1 Usage
Uses
Used in Pharmaceutical Synthesis:
1H-Imidazole-4-methanol, 1,5-dimethylis used as an intermediate in the synthesis of various pharmaceuticals, including antifungal and antiviral medications. Its unique chemical structure allows it to be a key component in the development of these medications, contributing to their efficacy and therapeutic properties.
Used in Medical Research:
1H-Imidazole-4-methanol, 1,5-dimethylhas been studied for its potential use in the treatment of various medical conditions. Its ability to interact with biological systems and modulate specific pathways makes it a promising candidate for further research and development in the medical field.
Used in Materials Science:
1H-Imidazole-4-methanol, 1,5-dimethylhas been identified as a potential building block for the development of new organic compounds and materials. Its unique properties and reactivity can be harnessed to create innovative materials with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 64689-22-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,6,8 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 64689-22:
(7*6)+(6*4)+(5*6)+(4*8)+(3*9)+(2*2)+(1*2)=161
161 % 10 = 1
So 64689-22-1 is a valid CAS Registry Number.
InChI:InChI=1S/C6H10N2O/c1-5-6(3-9)7-4-8(5)2/h4,9H,3H2,1-2H3
64689-22-1Relevant academic research and scientific papers
Synthesis of 4(5)-Hydroxymethylimidazoles by Hydroxymethylation and Decarboxylation of Imidazole-4(5)-carboxylic Acids
Kim, Choong S.,Lee, Kee J.,Kim, Hong S.,Chae, Yung B.
, p. 1417 - 1418 (2007/10/02)
4(5)-Hydroxymethylimidazoles were prepared by hydroxymethylation and decarboxylation of imidazole-4(5)-carboxylic acid esters.The reaction was simply carried out with aqueous formaldehyde solution in the presence of base.
Process for the production of hydroxymethylimidazoles
-
, (2008/06/13)
This invention discloses a process for the production of hydroxymethylimidazoles which comprises reacting imidazolecarboxylic acids, their esters or inorganic salts with a formaldehyde agent in the presence of an alkali in an aqueous medium.
