64762-96-5 Usage
Description
Diethyl 2,24-diacetyl-13-[6-[[2-(ethoxycarbonyl)-1,3-dioxobutyl]amino]hexyl]-3,12,14,23-tetraoxo-4,11,13,15,22-pentaazapentacosanedioate is a highly complex organic chemical compound characterized by its extensive molecular structure. It features multiple acetyl and oxo groups, as well as ethyl and amino groups, which contribute to its high molecular weight and complexity. As a derivative of pentaazapentacosanedioate, its intricate structure suggests potential applications in various fields of chemistry and biochemistry. However, due to its complexity, it may also pose potential hazards if mishandled.
Uses
Used in Chemical Research:
Diethyl 2,24-diacetyl-13-[6-[[2-(ethoxycarbonyl)-1,3-dioxobutyl]amino]hexyl]-3,12,14,23-tetraoxo-4,11,13,15,22-pentaazapentacosanedioate is used as a research compound for exploring its chemical properties and potential reactions in the field of organic chemistry.
Used in Biochemical Applications:
In the biochemistry industry, this compound may be utilized as a reagent or intermediate in the synthesis of more complex molecules, given its unique structure and functional groups.
Used in Pharmaceutical Development:
Due to its complex nature, diethyl 2,24-diacetyl-13-[6-[[2-(ethoxycarbonyl)-1,3-dioxobutyl]amino]hexyl]-3,12,14,23-tetraoxo-4,11,13,15,22-pentaazapentacosanedioate could be employed in the development of new pharmaceuticals, potentially serving as a precursor or a building block for novel drug molecules.
Used in Material Science:
In material science, this compound might be investigated for its potential to form new types of polymers or contribute to the development of advanced materials with unique properties.
Check Digit Verification of cas no
The CAS Registry Mumber 64762-96-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,7,6 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 64762-96:
(7*6)+(6*4)+(5*7)+(4*6)+(3*2)+(2*9)+(1*6)=155
155 % 10 = 5
So 64762-96-5 is a valid CAS Registry Number.
InChI:InChI=1/C41H68N6O14/c1-7-59-37(54)31(28(4)48)34(51)42-22-16-10-12-19-25-45-40(57)47(27-21-15-14-18-24-44-36(53)33(30(6)50)39(56)61-9-3)41(58)46-26-20-13-11-17-23-43-35(52)32(29(5)49)38(55)60-8-2/h31-33H,7-27H2,1-6H3,(H,42,51)(H,43,52)(H,44,53)(H,45,57)(H,46,58)