64906-00-9 Usage
Chemical structure
A synthetic compound with a complex structure, consisting of a pyrazolium ring, an isopropylamino group, and a tartrate ion.
Solubility
Water-soluble, which allows it to be easily dissolved in aqueous solutions for use in various assays and experiments.
Redox indicator
It is a stable redox indicator, which means it can be used to measure the redox state of a cell or a cell culture.
Cell viability measurement
It is commonly used to measure the viability of cells in culture, helping researchers determine the health and activity of the cells.
Applications in cell proliferation and cytotoxicity assays
This chemical is frequently employed in assays that measure cell proliferation (the rate at which cells divide and multiply) and cytotoxicity (the degree to which a substance is harmful to cells).
Cell counting and viability determination
It is used in various cell culture systems to count cells and determine their viability, which is essential for monitoring cell growth and assessing the effectiveness of treatments or experimental conditions.
Assessment of cell death and apoptosis
The compound is utilized in assays that evaluate cell death (necrosis) and apoptosis (programmed cell death), providing valuable information about the mechanisms underlying these processes.
High throughput screening reagent
It serves as a high throughput screening reagent in drug discovery, allowing researchers to quickly and efficiently screen large numbers of compounds for their potential effects on cellular activity and viability.
Research and clinical applications
This chemical plays a crucial role in monitoring and evaluating cellular activity and viability in various research and clinical applications, contributing to a better understanding of cell biology and the development of new therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 64906-00-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,9,0 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 64906-00:
(7*6)+(6*4)+(5*9)+(4*0)+(3*6)+(2*0)+(1*0)=129
129 % 10 = 9
So 64906-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N3O.C4H6O6/c1-10(2)15-13-11(3)16(4)17(14(13)18)12-8-6-5-7-9-12;5-1(3(7)8)2(6)4(9)10/h5-10,13,15H,1-4H3;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/p-1/t;1-,2?/m.1/s1
