64942-63-8 Usage
General Description
(5,5-DIMETHYL-2,4-DIOXO-IMIDAZOLIDIN-1-YL)-ACETIC ACID is a chemical compound with the molecular formula C7H11NO4. It is a derivative of imidazolidin-4-one, and is commonly used as a reagent in organic synthesis and pharmaceutical research. (5,5-DIMETHYL-2,4-DIOXO-IMIDAZOLIDIN-1-YL)-ACETIC ACID is known for its ability to undergo various chemical reactions, making it valuable for the development of new drug compounds and other organic molecules. Its precise applications can vary depending on the specific research or manufacturing needs, but it is often used as a building block in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Additionally, its unique molecular structure and reactivity make it a target for further study and exploration in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 64942-63-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,9,4 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 64942-63:
(7*6)+(6*4)+(5*9)+(4*4)+(3*2)+(2*6)+(1*3)=148
148 % 10 = 8
So 64942-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O4/c1-7(2)5(12)8-6(13)9(7)3-4(10)11/h3H2,1-2H3,(H,10,11)(H,8,12,13)
