650140-84-4 Usage
General Description
3,5-Dibromo-4-methoxypyridine-N-oxide is a chemical compound with the molecular formula C6H5Br2NO2. It is a pyridine derivative that contains two bromine atoms and a methoxy group. 3,5-DIBROMO-4-METHOXYPYRIDINE-N-OXIDE is often used in organic chemistry as a reagent in the preparation of various pyridine derivatives. It also has potential applications in pharmaceuticals and agrochemicals due to its unique chemical structure and reactivity. Additionally, 3,5-Dibromo-4-methoxypyridine-N-oxide exhibits strong oxidizing properties, making it useful in certain chemical reactions and processes. However, it is important to handle this compound with caution due to its potential health hazards and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 650140-84-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,0,1,4 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 650140-84:
(8*6)+(7*5)+(6*0)+(5*1)+(4*4)+(3*0)+(2*8)+(1*4)=124
124 % 10 = 4
So 650140-84-4 is a valid CAS Registry Number.
InChI:InChI=1S/C6H5Br2NO/c1-10-6-4(7)2-9-3-5(6)8/h2-3H,1H3
