651027-01-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3,5-difluorobenzoic acid is used as a building block for the synthesis of pharmaceutical compounds. Its unique structure with fluorine and bromine atoms allows for the development of new drugs with specific properties and therapeutic effects.
Used in Agrochemical Industry:
2-Bromo-3,5-difluorobenzoic acid is used as a precursor in the synthesis of agrochemicals. Its chemical properties make it suitable for the development of new pesticides or herbicides with improved efficacy and selectivity.
Used in Organic Synthesis:
2-Bromo-3,5-difluorobenzoic acid is used as a versatile building block in various organic reactions. Its presence of fluorine and bromine atoms enables the formation of new compounds with different functional groups and applications in research and industry.
Used in Research Applications:
2-Bromo-3,5-difluorobenzoic acid is valuable for research purposes, as it can be used to study the effects of fluorine and bromine substitution on the properties and reactivity of benzoic acid derivatives. This knowledge can contribute to the development of new synthetic methods and applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 651027-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,1,0,2 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 651027-01:
(8*6)+(7*5)+(6*1)+(5*0)+(4*2)+(3*7)+(2*0)+(1*1)=119
119 % 10 = 9
So 651027-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF2O2/c8-6-4(7(11)12)1-3(9)2-5(6)10/h1-2H,(H,11,12)
