651310-24-6 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-4-methylisoquinoline is used as an intermediate compound for the synthesis of various pharmaceutical drugs. Its unique structure allows it to be a key component in the development of new medications, particularly those targeting neurological disorders and pain management.
Used in Chemical Research:
In the field of chemical research, 5-Bromo-4-methylisoquinoline serves as a valuable compound for studying the properties and reactions of isoquinoline derivatives. Its presence in various chemical reactions can provide insights into the behavior of similar compounds and contribute to the advancement of organic chemistry.
Used in Material Science:
5-Bromo-4-methylisoquinoline is used as a building block in the development of new materials with specific properties. Its incorporation into polymers and other materials can lead to the creation of substances with tailored characteristics, such as improved conductivity or enhanced stability, which can be applied in various industries.
Used in Dye and Pigment Industry:
5-Bromo-4-methylisoquinoline is used as a precursor in the synthesis of dyes and pigments. Its ability to form colored compounds makes it a valuable resource in the production of a wide range of colorants used in various applications, including textiles, plastics, and inks.
Used in Analytical Chemistry:
5-Bromo-4-methylisoquinoline is used as a reference compound in analytical chemistry for the calibration of instruments and the development of analytical methods. Its distinct properties make it a reliable standard for comparing and measuring the characteristics of other compounds in various chemical analyses.
Check Digit Verification of cas no
The CAS Registry Mumber 651310-24-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,1,3,1 and 0 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 651310-24:
(8*6)+(7*5)+(6*1)+(5*3)+(4*1)+(3*0)+(2*2)+(1*4)=116
116 % 10 = 6
So 651310-24-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrN/c1-7-5-12-6-8-3-2-4-9(11)10(7)8/h2-6H,1H3
651310-24-6Relevant articles and documents
5-Substituted isoquinoline derivatives
-
Page 105, (2010/02/10)
A compound represented by the following formula (1) or a salt thereof: wherein R1 represents hydrogen atom, a halogen atom and the like; R2 represents hydrogen atom, a halogen atom, a C1-6 alkyl group and the like; and R3 represents —O—X—C(A1)(A11)—C(A2)(A2l)—N(A3l)(A3)(X represents propylene group etc., A11 and A21 represent hydrogen atom, or a C1-6 alkyl group, A31 represents a C1-6 alkyl group substituted with hydroxyl group, or hydrogen atom, and A1, A2, and A3 represent hydrogen atom, a C1-6 alkyl group and the like) and the like, which has an inhibitory activity on the phosphorylation of myosin regulatory light chain, and is useful for treatment of diseases relating to contraction of various cells and the like.
