6516-95-6 Usage
Molecular structure
Contains a quinoline ring and a pyridine ring.
Chemical compound
1-Methyl-6-(4-pyridinyl)-1,2,3,4-tetrahydroquinoline, also known as MPQT.
Research applications
Used in various research applications, especially in medicinal chemistry.
Potential pharmacological activities
Exhibits a wide range of biological properties.
Biological properties
Antioxidant, antifungal, and antitumor activities.
Drug development
A valuable target for drug development.
Neurodegenerative diseases
Studied for its potential role in treating neurodegenerative diseases.
Metal-ion complexation
Acts as a ligand in metal-ion complexation.
Therapeutic and research purposes
Holds promise for various therapeutic and research purposes due to its unique structure and diverse biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 6516-95-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,1 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6516-95:
(6*6)+(5*5)+(4*1)+(3*6)+(2*9)+(1*5)=106
106 % 10 = 6
So 6516-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2/c1-17-10-2-3-14-11-13(4-5-15(14)17)12-6-8-16-9-7-12/h4-9,11H,2-3,10H2,1H3
