65169-58-6 Usage
Uses
Used in Pharmaceutical Industry:
6-Cyano-2-methyl-3-nitropyridine is used as a key intermediate for the synthesis of various pharmaceuticals. Its unique structure, featuring both a cyano and a nitro group, allows for the creation of a broad range of organic compounds that can be further utilized in drug development. 6-Cyano-2-methyl-3-nitropyridine plays a crucial role in the production of new medications, contributing to advancements in healthcare and medicine.
Used in Agrochemical Industry:
In the agrochemical sector, 6-Cyano-2-methyl-3-nitropyridine is employed as an intermediate in the synthesis of crop protection products. Its chemical properties make it suitable for the development of compounds that can protect crops from pests and diseases, thereby enhancing agricultural productivity and food security.
Used in Chemical Research and Development:
6-Cyano-2-methyl-3-nitropyridine is utilized as a valuable reagent in chemical research and development. Its presence in the laboratory facilitates the exploration of new chemical reactions and the synthesis of novel organic compounds, which can lead to breakthroughs in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 65169-58-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,1,6 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 65169-58:
(7*6)+(6*5)+(5*1)+(4*6)+(3*9)+(2*5)+(1*8)=146
146 % 10 = 6
So 65169-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O2/c1-5-7(10(11)12)3-2-6(4-8)9-5/h2-3H,1H3
