65189-70-0 Usage
General Description
The chemical sequence "ARG-ARG-LYS-ALA-SER-GLY-PRO" represents a peptide composed of the amino acids arginine, lysine, alanine, serine, glycine, and proline. This sequence is rich in positively charged amino acids (arginine and lysine) and contains a mixture of hydrophobic and polar amino acids. Peptides like this one can have various biological functions, including serving as signaling molecules, antimicrobial agents, or structural components of larger proteins. Additionally, this specific sequence may have potential applications in drug development, biomaterials, or biotechnology due to its composition and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 65189-70-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,1,8 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 65189-70:
(7*6)+(6*5)+(5*1)+(4*8)+(3*9)+(2*7)+(1*0)=150
150 % 10 = 0
So 65189-70-0 is a valid CAS Registry Number.
InChI:InChI=1/C31H58N14O9/c1-17(24(48)44-21(16-46)26(50)40-15-23(47)45-14-6-10-22(45)29(53)54)41-27(51)19(8-2-3-11-32)43-28(52)20(9-5-13-39-31(36)37)42-25(49)18(33)7-4-12-38-30(34)35/h17-22,46H,2-16,32-33H2,1H3,(H,40,50)(H,41,51)(H,42,49)(H,43,52)(H,44,48)(H,53,54)(H4,34,35,38)(H4,36,37,39)