65189-70-0 Usage
Uses
Used in Drug Development:
ARG-ARG-LYS-ALA-SER-GLY-PRO is used as a potential candidate in drug development for its unique composition and properties. The peptide's positively charged amino acids and mixture of hydrophobic and polar amino acids may contribute to its interaction with biological targets, making it a promising candidate for the development of new therapeutic agents.
Used in Biomaterials:
In the field of biomaterials, ARG-ARG-LYS-ALA-SER-GLY-PRO is used as a component in the design and development of biocompatible materials. The peptide's properties, such as its charge and hydrophobicity, can be leveraged to create materials with specific characteristics, such as improved cell adhesion, enhanced bioactivity, or controlled release of bioactive molecules.
Used in Biotechnology:
ARG-ARG-LYS-ALA-SER-GLY-PRO is utilized in biotechnology applications for its potential as a signaling molecule or antimicrobial agent. The peptide's composition and properties may allow it to be engineered into biotechnological processes or products, such as biosensors, diagnostic tools, or therapeutic agents targeting specific pathogens.
Used in Antimicrobial Applications:
In the context of antimicrobial applications, ARG-ARG-LYS-ALA-SER-GLY-PRO is used as an antimicrobial peptide for its ability to interact with and disrupt the integrity of microbial cell membranes. The positively charged amino acids in the sequence can facilitate electrostatic interactions with negatively charged bacterial cell surfaces, leading to membrane permeabilization and subsequent antimicrobial activity.
Used in Structural Components of Larger Proteins:
ARG-ARG-LYS-ALA-SER-GLY-PRO is also used as a structural component in the assembly of larger proteins. The peptide's unique sequence and properties can contribute to the overall stability, folding, or function of the larger protein complex, making it a valuable component in protein engineering and design.
Check Digit Verification of cas no
The CAS Registry Mumber 65189-70-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,1,8 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 65189-70:
(7*6)+(6*5)+(5*1)+(4*8)+(3*9)+(2*7)+(1*0)=150
150 % 10 = 0
So 65189-70-0 is a valid CAS Registry Number.
InChI:InChI=1/C31H58N14O9/c1-17(24(48)44-21(16-46)26(50)40-15-23(47)45-14-6-10-22(45)29(53)54)41-27(51)19(8-2-3-11-32)43-28(52)20(9-5-13-39-31(36)37)42-25(49)18(33)7-4-12-38-30(34)35/h17-22,46H,2-16,32-33H2,1H3,(H,40,50)(H,41,51)(H,42,49)(H,43,52)(H,44,48)(H,53,54)(H4,34,35,38)(H4,36,37,39)