652148-90-8 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloropyridine-2-boronic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of biologically active molecules. Its presence in the molecular structure can enhance the pharmacological properties of drugs, making it an essential component in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical sector, 6-Chloropyridine-2-boronic acid is utilized as a building block for the creation of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals that require specific molecular structures for their intended applications.
Used in Chemical Research and Development:
6-Chloropyridine-2-boronic acid is employed as a research tool in chemical laboratories, where it is used to explore new synthetic pathways and develop innovative chemical compounds. Its reactivity and ability to form stable complexes make it a valuable asset in advancing the understanding of chemical reactions and mechanisms.
Used in Ligand Design:
6-Chloropyridine-2-boronic acid is used as a component in ligand design due to its capacity to form stable complexes with metal ions. This property is crucial for the development of catalysts and other coordination compounds that require specific binding interactions for their function.
Used in Metal-Catalyzed Cross-Coupling Reactions:
As a boronic acid derivative, 6-Chloropyridine-2-boronic acid is instrumental in metal-catalyzed cross-coupling reactions, which are widely used in the synthesis of complex organic molecules. Its participation in these reactions facilitates the formation of carbon-carbon and carbon-heteroatom bonds, which are fundamental in constructing diverse molecular architectures.
Check Digit Verification of cas no
The CAS Registry Mumber 652148-90-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,2,1,4 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 652148-90:
(8*6)+(7*5)+(6*2)+(5*1)+(4*4)+(3*8)+(2*9)+(1*0)=158
158 % 10 = 8
So 652148-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BClNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3,9-10H
