65340-75-2 Usage
General Description
4-Amino-8-bromoquinoline is a chemical compound with the molecular formula C9H7BrN2. It is a yellow crystalline solid that is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. 4-AMINO-8-BROMOQUINOLINE possesses both amino and bromo functional groups, making it useful as a precursor in the development of various drugs and pesticides. Additionally, 4-amino-8-bromoquinoline has been studied for its potential anti-cancer and antimicrobial properties, further highlighting its importance in medicinal chemistry. Its diverse range of applications, particularly in drug development, make 4-amino-8-bromoquinoline an important and versatile chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 65340-75-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,3,4 and 0 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 65340-75:
(7*6)+(6*5)+(5*3)+(4*4)+(3*0)+(2*7)+(1*5)=122
122 % 10 = 2
So 65340-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-5H,(H2,11,12)
