65456-71-5 Usage
General Description
5(4)-AMINOIMIDAZOLE-4(5)-CARBOXAMIDOXIME DIHYDROCHLORIDE is a chemical compound where the imidazole and carboxamidoxime groups are present. It is a dihydrochloride salt and is commonly used as a reagent in biochemical research and analysis. 5(4)-AMINOIMIDAZOLE-4(5)-CARBOXAMIDOXIME DIHYDROCHLORIDE has been studied for its potential use in the treatment of various diseases such as cancer and neurological disorders. It is also used as a chelating agent and has been investigated for its potential antioxidant and anti-inflammatory properties. Additionally, it has been studied for its potential role in the synthesis of coordination compounds and metal complexes.
Check Digit Verification of cas no
The CAS Registry Mumber 65456-71-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,4,5 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 65456-71:
(7*6)+(6*5)+(5*4)+(4*5)+(3*6)+(2*7)+(1*1)=145
145 % 10 = 5
So 65456-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N5O.ClH/c5-3-2(4(6)9-10)7-1-8-3;/h1,9-10H,6H2,(H2,5,7,8);1H/b4-2+;