65478-62-8 Usage
Uses
Used in Organic Synthesis:
N-(5-Methyl-1-Oxido-2-Pyridinyl) Acetamide is utilized as a building block in organic synthesis for the creation of various pharmaceutical drugs and bioactive compounds. Its unique structure allows for the formation of diverse chemical entities with potential therapeutic properties.
Used in Pharmaceutical Research:
In the pharmaceutical industry, N-(5-Methyl-1-Oxido-2-Pyridinyl) Acetamide serves as a valuable component in the development of new drug molecules. Its incorporation into drug candidates can lead to the discovery of novel therapeutic agents with improved efficacy and safety profiles.
Used as a Reagent in Chemical Reactions:
N-(5-Methyl-1-Oxido-2-Pyridinyl) Acetamide is employed as a reagent in various chemical reactions, facilitating the synthesis of complex organic molecules. Its reactivity and stability make it a suitable choice for a wide range of chemical processes.
Used in the Preparation of Heterocyclic Compounds:
As a precursor, N-(5-Methyl-1-Oxido-2-Pyridinyl) Acetamide is instrumental in the synthesis of heterocyclic compounds, which are essential in the development of pharmaceuticals, agrochemicals, and other specialty chemicals. Its presence in these compounds can enhance their biological activity and selectivity.
Used in Medicinal Chemistry:
N-(5-Methyl-1-Oxido-2-Pyridinyl) Acetamide has garnered interest in the field of medicinal chemistry due to its pharmacological activities. Its potential applications in the development of new drug molecules make it a promising candidate for further research and development in the pharmaceutical sector.
Check Digit Verification of cas no
The CAS Registry Mumber 65478-62-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,4,7 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 65478-62:
(7*6)+(6*5)+(5*4)+(4*7)+(3*8)+(2*6)+(1*2)=158
158 % 10 = 8
So 65478-62-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-6-3-4-8(9-7(2)11)10(12)5-6/h3-5,12H,1-2H3/b9-8+
65478-62-8Relevant academic research and scientific papers
OREXIN RECEPTOR ANTAGONISTS
-
Page/Page column 96, (2014/01/18)
The disclosures herein relate to novel compounds of formula wherein W, X and Y1, Y2, Y3 and Y4 are defined herein, and their use in treating, preventing, ameliorating, controlling or reducing the risk of neurological or psychiatric disorders associated with orexin receptors.
Self-assembly of organocatalysts: Fine-tuning organocatalytic reactions
Clarke, Matthew L.,Fuentes, Jose A.
, p. 930 - 933 (2008/02/01)
(Chemical Equation Presented) A cat. with two tales: Hydrogen-bonding interactions between achiral pyridinone additives and unselective chiral proline-derived organocatalysts (see picture) result in highly effective catalysts for the Michael addition of n
