65492-85-5 Usage
Description
(1S)-6,7-Dimethoxy-1-methyl-2-(1-methylethyl)-1,2,3,4-tetrahydroisoquinoline is a naturally occurring chemical compound that belongs to the class of tetrahydroisoquinoline alkaloids. It is found in various plant species and has been studied for its potential biological activities, including antioxidant, anti-inflammatory, and analgesic properties. (1S)-6,7-Dimethoxy-1-methyl-2-(1-methylethyl)-1,2,3,4-tetrahydroisoquinoline has also been investigated for its potential as a treatment for neurological disorders and as a possible lead compound for drug development. Its unique chemical structure and pharmacological properties make it an interesting target for further research and potential therapeutic applications.
Uses
Used in Pharmaceutical Industry:
(1S)-6,7-Dimethoxy-1-methyl-2-(1-methylethyl)-1,2,3,4-tetrahydroisoquinoline is used as a potential treatment for neurological disorders due to its antioxidant, anti-inflammatory, and analgesic properties. It is also considered as a possible lead compound for drug development, given its unique chemical structure and pharmacological properties.
Used in Research and Development:
(1S)-6,7-Dimethoxy-1-methyl-2-(1-methylethyl)-1,2,3,4-tetrahydroisoquinoline is used as a subject of research for further understanding its biological activities and potential therapeutic applications. Its unique chemical structure and pharmacological properties make it an interesting target for scientists and researchers to explore its potential in various fields of medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 65492-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,4,9 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 65492-85:
(7*6)+(6*5)+(5*4)+(4*9)+(3*2)+(2*8)+(1*5)=155
155 % 10 = 5
So 65492-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H23NO2/c1-10(2)16-7-6-12-8-14(17-4)15(18-5)9-13(12)11(16)3/h8-11H,6-7H2,1-5H3
