65492-87-7 Usage
General Description
The chemical compound (1S)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-methyl-2-(4-nitrophenyl)isoquinoline is a complex organic molecule with a tetrahydroisoquinoline core structure. It features two methoxy groups and a methyl group attached to the isoquinoline ring, as well as a nitrophenyl group at position two. The compound is chiral, with a single stereocenter at the first position of the isoquinoline ring. The molecule has potential applications in medicinal chemistry and drug development due to its unique structure and pharmacological properties, making it an interesting target for further study and research.
Check Digit Verification of cas no
The CAS Registry Mumber 65492-87-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,4,9 and 2 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 65492-87:
(7*6)+(6*5)+(5*4)+(4*9)+(3*2)+(2*8)+(1*7)=157
157 % 10 = 7
So 65492-87-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O4/c1-12-16-11-18(24-3)17(23-2)10-13(16)8-9-19(12)14-4-6-15(7-5-14)20(21)22/h4-7,10-12H,8-9H2,1-3H3