655247-45-3 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 3-chloro-pyrazine-2-carboxylate is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of novel heterocyclic compounds with potential therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, ethyl 3-chloro-pyrazine-2-carboxylate is utilized as a building block in the creation of agrochemicals, such as pesticides and herbicides, due to its potential to enhance the effectiveness of these products.
Used in Flavoring Industry:
Ethyl 3-chloro-pyrazine-2-carboxylate is employed as a flavoring agent, leveraging its unique chemical properties to impart specific tastes and aromas in food and beverage products.
Used in Organic Chemistry Research and Development:
As a valuable research tool, ethyl 3-chloro-pyrazine-2-carboxylate is used in the study and development of functional organic materials, contributing to the advancement of organic chemistry and the discovery of new compounds with various applications.
Used in the Synthesis of Novel Heterocyclic Compounds:
Ethyl 3-chloro-pyrazine-2-carboxylate is utilized as a key component in the synthesis of innovative heterocyclic compounds that possess biological activities, making it an essential part of the process for creating new pharmaceuticals and other bioactive substances.
Check Digit Verification of cas no
The CAS Registry Mumber 655247-45-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,5,2,4 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 655247-45:
(8*6)+(7*5)+(6*5)+(5*2)+(4*4)+(3*7)+(2*4)+(1*5)=173
173 % 10 = 3
So 655247-45-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN2O2/c1-2-12-7(11)5-6(8)10-4-3-9-5/h3-4H,2H2,1H3
