65550-79-0 Usage
General Description
2-Bromo-5-chloronicotinic acid is a chemical compound that belongs to the class of organic compounds known as pyridinecarboxylic acids. It is a derivative of nicotinic acid, a compound commonly found in plants and used in the treatment of high cholesterol and high triglycerides. 2-Bromo-5-chloronicotinic acid is primarily used in the synthesis of various pharmaceuticals and agrochemicals. It is also used as an intermediate for the production of other chemical compounds, such as fungicides and herbicides. 2-Bromo-5-chloronicotinic acid has potential application in the field of medicinal chemistry due to its biological activities, including antimicrobial and antifungal properties. Additionally, it has been studied for its potential to inhibit certain enzymes and receptors, making it a promising candidate for drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 65550-79-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,5,5 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 65550-79:
(7*6)+(6*5)+(5*5)+(4*5)+(3*0)+(2*7)+(1*9)=140
140 % 10 = 0
So 65550-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrClNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2H,(H,10,11)