65550-81-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-3-chloro-5-picoline is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, making it an essential component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Bromo-3-chloro-5-picoline serves as a crucial intermediate for the production of pesticides and other agrochemicals. Its incorporation into these compounds can enhance their effectiveness in controlling pests and diseases in agriculture.
Used in Dye Industry:
2-BROMO-3-CHLORO-5-PICOLINE is also employed in the dye industry, where it contributes to the creation of a range of dyes with specific color properties. Its chemical structure plays a significant role in determining the color and stability of the resulting dyes.
Used in Organic Compounds Production:
2-Bromo-3-chloro-5-picoline is used in the production of various organic compounds, leveraging its reactivity and structural features to synthesize a wide array of chemical products with diverse applications.
Used in Chemical Research and Development:
2-BROMO-3-CHLORO-5-PICOLINE is also valuable in the research and development of new chemical processes and products. Its unique properties make it a promising candidate for exploring novel chemical reactions and syntheses, potentially leading to the discovery of innovative materials and applications.
Overall, 2-Bromo-3-chloro-5-picoline is a multifaceted chemical intermediate with applications spanning across various industries, including pharmaceuticals, agrochemicals, dyes, and organic compounds production, as well as in the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 65550-81-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,5,5 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 65550-81:
(7*6)+(6*5)+(5*5)+(4*5)+(3*0)+(2*8)+(1*1)=134
134 % 10 = 4
So 65550-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrClN/c1-4-2-5(8)6(7)9-3-4/h2-3H,1H3
65550-81-4Relevant academic research and scientific papers
Herbicidal pyridine compounds
-
, (2008/06/13)
Herbicidal 3- and/or 5-halogenomethyl-pyrid-2-yloxyphenoxy compounds and processes for making and using the same. Intermediates for making these compounds and their preparation are also disclosed. Thus, for example, 2-chloro-5-trichloromethylpyridine is prepared by a liquid phase chlorination of 3-methylpyridine under the influence of ultra violet light.
