65674-04-6 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-8-nitroquinolin-4-ol is used as an intermediate in the synthesis of various pharmaceuticals for its potential to contribute to the development of new compounds with therapeutic applications. Its unique structure allows for the creation of molecules that can target specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical sector, 3-chloro-8-nitroquinolin-4-ol is utilized as an intermediate in the production of agrochemicals, where its antimicrobial properties can be harnessed to develop compounds that protect crops from diseases and pests, thereby increasing agricultural productivity.
Used in Antimalarial Applications:
3-Chloro-8-nitroquinolin-4-ol is studied for its potential antimalarial properties, making it a candidate for the development of new antimalarial drugs. Its ability to interfere with the life cycle of the malaria parasite or inhibit essential enzymes could provide a new avenue for treating this disease.
Used in Antimicrobial Applications:
3-CHLORO-8-NITROQUINOLIN-4-OL is also considered for its antimicrobial potential, which can be applied in the development of new antibiotics or antifungal agents. This is particularly relevant in the context of increasing antibiotic resistance, where novel compounds with unique modes of action are urgently needed.
Check Digit Verification of cas no
The CAS Registry Mumber 65674-04-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,6,7 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 65674-04:
(7*6)+(6*5)+(5*6)+(4*7)+(3*4)+(2*0)+(1*4)=146
146 % 10 = 6
So 65674-04-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H5ClN2O3/c10-6-4-11-8-5(9(6)13)2-1-3-7(8)12(14)15/h1-4H,(H,11,13)
65674-04-6Relevant academic research and scientific papers
QUINOLINE COMPOUNDS AS H+-ATPASES
-
, (2008/06/13)
This invention relates to a quinoline compound of the formula: wherein R1 is a pyridyl group or aryl, each of which may be substituted with suitable substituent(s), A -COHN-or -NHCO-, n is an integer of 0 or 1, and is a group of the formula: In which R2, R3, R4, R5, R6 and R7 are as defined, and pharmaceutically acceptable salt thereof, to processes for preparation thereof, to a pharmaceutical composition comprising the same, and to a method for the prevention and/or the treatment of bone diseases caused by abnormal bone metabolism in human being or animals.
