65717-66-0 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-2,3,5-TRIFLUORO-6-HYDRAZINOPYRIDINE is used as a building block for the synthesis of various drugs and pharmaceutical agents. Its hydrazine functional group allows for the formation of various chemical bonds, making it a versatile component in the creation of new medicinal compounds.
Used in Organic Synthesis:
4-BROMO-2,3,5-TRIFLUORO-6-HYDRAZINOPYRIDINE is used as a reagent in organic synthesis and chemical research. Its presence of bromine and fluorine atoms, along with the hydrazine group, enables it to participate in a variety of chemical reactions, facilitating the synthesis of complex organic molecules.
Used in Agrochemical Development:
4-BROMO-2,3,5-TRIFLUORO-6-HYDRAZINOPYRIDINE has potential applications in the development of agrochemicals. Its unique properties can be harnessed to create new compounds that can be used in agriculture for pest control, crop protection, and other related applications.
Used in Materials Science:
4-BROMO-2,3,5-TRIFLUORO-6-HYDRAZINOPYRIDINE also has potential applications in materials science. Its chemical structure can be utilized to develop new materials with specific properties, such as high thermal stability, chemical resistance, or other desirable characteristics for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 65717-66-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,7,1 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 65717-66:
(7*6)+(6*5)+(5*7)+(4*1)+(3*7)+(2*6)+(1*6)=150
150 % 10 = 0
So 65717-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrF3N3/c6-1-2(7)4(9)11-5(12-10)3(1)8/h10H2,(H,11,12)
