65816-20-8 Usage
General Description
Ethyl 4-[[(ethylphenylamino)methylene]amino]benzoate is a chemical compound with complex structure. This organic compound contains the functional groups of esters, amines and aromatic rings. The presence of these groups allows this compound to participate in various chemical reactions. It can have numerous applications based on its structural features, such as in the pharmaceutical industry or in the production of dyes or pigments. However, like most compounds, it needs to be carefully handled and appropriate safety measures should be taken during its use. The exact properties such as reactivity, toxicity, flammability of this compound will largely depend on its specific structure and the conditions under which it is used.
Check Digit Verification of cas no
The CAS Registry Mumber 65816-20-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,8,1 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 65816-20:
(7*6)+(6*5)+(5*8)+(4*1)+(3*6)+(2*2)+(1*0)=138
138 % 10 = 8
So 65816-20-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O2/c1-3-20(17-8-6-5-7-9-17)14-19-16-12-10-15(11-13-16)18(21)22-4-2/h5-14H,3-4H2,1-2H3/b19-14+
