65825-21-0 Usage
Description
(4-Fluorophenyl)methyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate is a complex chemical compound that features a fluorophenyl group, a 4-chlorobenzoyl group, a 5-methoxy-2-methyl-1H-indole-3-acetate group, and a methyl group. Its intricate molecular structure may endow it with potential medicinal properties or make it a candidate for research applications, although further studies are necessary to determine its specific uses and effects.
Uses
Used in Pharmaceutical Research:
(4-Fluorophenyl)methyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate is used as a research compound for exploring its potential medicinal properties. Its unique structural features suggest that it could be a candidate for the development of new drugs or therapies, pending further investigation into its pharmacological activity and safety.
Used in Chemical Synthesis:
In the chemical industry, (4-Fluorophenyl)methyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate may be utilized as an intermediate in the synthesis of more complex organic compounds or as a building block for the creation of novel molecules with specific applications in various fields, such as materials science or specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 65825-21-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,8,2 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 65825-21:
(7*6)+(6*5)+(5*8)+(4*2)+(3*5)+(2*2)+(1*1)=140
140 % 10 = 0
So 65825-21-0 is a valid CAS Registry Number.
InChI:InChI=1/C26H21ClFNO4/c1-16-22(14-25(30)33-15-17-3-9-20(28)10-4-17)23-13-21(32-2)11-12-24(23)29(16)26(31)18-5-7-19(27)8-6-18/h3-13H,14-15H2,1-2H3