65833-09-2 Usage
Uses
Used in Pharmaceutical Industry:
1-(3,5-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is used as a potential pharmaceutical agent for its diverse biological activities. 1-(3,5-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE's antibacterial, antifungal, and antineoplastic properties make it a valuable candidate for the development of new drugs to treat various diseases and infections.
Used in Organic Synthesis:
1-(3,5-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure and reactivity allow for the creation of new molecules with potential applications in various fields, including materials science, agrochemicals, and pharmaceuticals.
Used in Drug Discovery and Development:
1-(3,5-DIMETHYL-PHENYL)-PYRROLE-2,5-DIONE is used as a starting point for the discovery and development of novel pharmaceutical agents. Its structural versatility and potential for modification make it an attractive candidate for the design of new drugs with improved efficacy, selectivity, and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 65833-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,8,3 and 3 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 65833-09:
(7*6)+(6*5)+(5*8)+(4*3)+(3*3)+(2*0)+(1*9)=142
142 % 10 = 2
So 65833-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO2/c1-8-5-9(2)7-10(6-8)13-11(14)3-4-12(13)15/h3-7H,1-2H3
