6595-78-4 Usage
Uses
Used in Pharmaceutical Industry:
5-(CHLOROMETHYL)-3-(3-NITROPHENYL)-1,2,4-OXADIAZOLE is used as a building block for the synthesis of various bioactive compounds, including antimicrobial and anticancer agents. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Antimicrobial Applications:
In the field of antimicrobial research, 5-(CHLOROMETHYL)-3-(3-NITROPHENYL)-1,2,4-OXADIAZOLE is used as a potential agent for the development of new antimicrobial drugs. Its chemical structure can be modified to target specific pathogens and improve the effectiveness of existing treatments.
Used in Anticancer Applications:
5-(CHLOROMETHYL)-3-(3-NITROPHENYL)-1,2,4-OXADIAZOLE is also used as a potential anticancer agent. Its unique structure allows for the development of new drugs that can target cancer cells more effectively and with fewer side effects.
Used in Pharmacological Research:
In pharmacological research, 5-(CHLOROMETHYL)-3-(3-NITROPHENYL)-1,2,4-OXADIAZOLE has been studied for its potential anti-inflammatory and analgesic properties. Its ability to modulate various biological pathways makes it a promising candidate for the development of new drugs to treat inflammation and pain.
Check Digit Verification of cas no
The CAS Registry Mumber 6595-78-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,9 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6595-78:
(6*6)+(5*5)+(4*9)+(3*5)+(2*7)+(1*8)=134
134 % 10 = 4
So 6595-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H6ClN3O3/c10-5-8-11-9(12-16-8)6-2-1-3-7(4-6)13(14)15/h1-4H,5H2
