65989-45-9 Usage
Uses
Used in Pharmaceutical Industry:
5-AMINO-2-MORPHOLIN-4-YL-BENZOIC ACID is used as a building block for the synthesis of various biologically active compounds for the development of pharmaceuticals. Its unique structure allows for the creation of anti-cancer and anti-inflammatory agents, making it a valuable component in drug discovery and design.
Used in Agrochemical Industry:
5-AMINO-2-MORPHOLIN-4-YL-BENZOIC ACID is used as a key intermediate in the synthesis of agrochemicals, contributing to the development of effective and targeted pest control solutions.
Used in Drug Development:
5-AMINO-2-MORPHOLIN-4-YL-BENZOIC ACID is used as a cysteine protease inhibitor, which has potential applications in the development of new drugs for various therapeutic areas, including the treatment of diseases where cysteine proteases play a crucial role.
Check Digit Verification of cas no
The CAS Registry Mumber 65989-45-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,9,8 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 65989-45:
(7*6)+(6*5)+(5*9)+(4*8)+(3*9)+(2*4)+(1*5)=189
189 % 10 = 9
So 65989-45-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O3/c12-8-1-2-10(9(7-8)11(14)15)13-3-5-16-6-4-13/h1-2,7H,3-6,12H2,(H,14,15)
