660425-07-0 Usage
Description
5-Chloropyridazin-3-ol is a white to light red crystalline compound with the chemical formula C4H3ClNO. It is an organic compound belonging to the pyridazinone class, which is characterized by the presence of a pyridazine ring fused with a pyridone ring. 5-CHLOROPYRIDAZIN-3-OL is known for its potential applications in the pharmaceutical and chemical industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
5-Chloropyridazin-3-ol is used as a key intermediate in the synthesis of various pharmaceutical compounds. One of its primary applications is in the preparation of 1,5,6,7-tetrahydro-4H-pyrazolo[4,3-c]pyridin-4-one compounds, which are known as GPR52 modulator compounds. GPR52 is a G-protein coupled receptor that has been implicated in various physiological processes and diseases, making it an important target for drug development. By modulating the activity of GPR52, these compounds can potentially be used to treat a range of conditions, including neurological disorders and metabolic diseases.
Used in Chemical Synthesis:
In addition to its pharmaceutical applications, 5-chloropyridazin-3-ol can also be used as a building block in the synthesis of other organic compounds. Its unique chemical structure allows it to be a versatile starting material for the development of new molecules with potential applications in various industries, such as agrochemicals, dyes, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 660425-07-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,0,4,2 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 660425-07:
(8*6)+(7*6)+(6*0)+(5*4)+(4*2)+(3*5)+(2*0)+(1*7)=140
140 % 10 = 0
So 660425-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H3ClN2O/c5-3-1-4(8)7-6-2-3/h1-2H,(H,7,8)
