66053-93-8 Usage
Uses
Used in Pharmaceutical Industry:
(3,4,5-Trimethyl-pyrazol-1-yl)-acetic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new compounds with potential therapeutic applications. Its unique properties allow for the creation of drugs that can address a wide range of health conditions.
Used in Agricultural Chemical Industry:
In the agricultural sector, (3,4,5-Trimethyl-pyrazol-1-yl)-acetic acid is utilized as a building block in the production of agrochemicals, such as pesticides and herbicides. Its reactivity and chemical structure enable the development of effective compounds that can protect crops and enhance agricultural productivity.
Used in Medicinal Chemistry Research:
(3,4,5-Trimethyl-pyrazol-1-yl)-acetic acid is employed as a valuable tool in medicinal chemistry research, where it aids in the exploration of new chemical entities and the optimization of drug candidates. Its versatile nature allows researchers to investigate its potential in various therapeutic areas and improve the efficacy and safety of existing medications.
Used in Chemical Synthesis:
As a chemical compound with a diverse range of applications, (3,4,5-Trimethyl-pyrazol-1-yl)-acetic acid is used in chemical synthesis to create a variety of compounds for different industries. Its unique properties make it an essential component in the development of new materials and products with specific functionalities and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 66053-93-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,0,5 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 66053-93:
(7*6)+(6*6)+(5*0)+(4*5)+(3*3)+(2*9)+(1*3)=128
128 % 10 = 8
So 66053-93-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O2/c1-5-6(2)9-10(7(5)3)4-8(11)12/h4H2,1-3H3,(H,11,12)
