66085-76-5 Usage
General Description
Nitroviolanthrene-5,10-dione, also known as NVD, is a chemical compound that belongs to the violanthrene family. It is a crystalline solid that is primarily used as an intermediate in the synthesis of various organic compounds. NVD contains a nitro group and two carbonyl groups, which make it a versatile building block for the production of dyes, pigments, and pharmaceuticals. Additionally, it exhibits fluorescence, which makes it useful in materials science and optical applications. Its unique chemical structure and properties make it a valuable component in the development of diverse products across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 66085-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,0,8 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 66085-76:
(7*6)+(6*6)+(5*0)+(4*8)+(3*5)+(2*7)+(1*6)=145
145 % 10 = 5
So 66085-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C34H15NO4/c36-33-24-4-2-1-3-17(24)18-7-8-19-20-9-10-23-28-15-16(35(38)39)5-6-25(28)34(37)27-14-12-22(30(20)32(23)27)21-11-13-26(33)31(18)29(19)21/h1-15H