66109-88-4 Usage
General Description
4-Phenyltetrahydro-2H-pyran-4-carboxaldehyde is a chemical compound with the molecular formula C13H16O2. It is a colorless to pale yellow liquid with a sweet, floral odor. 4-PHENYLTETRAHYDRO-2H-PYRAN-4-CARBOXALDEHYDE is commonly used as a fragrance ingredient in various consumer products, including perfumes, colognes, and personal care products. It is also used in the production of flavorings and as a building block for the synthesis of other chemicals. Additionally, 4-phenyltetrahydro-2H-pyran-4-carboxaldehyde has been studied for its potential pharmacological properties, including its ability to inhibit the growth of cancer cells and its potential as a neuroprotective agent. However, further research is needed to fully understand its effects and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 66109-88-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,1,0 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 66109-88:
(7*6)+(6*6)+(5*1)+(4*0)+(3*9)+(2*8)+(1*8)=134
134 % 10 = 4
So 66109-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H14O2/c13-10-12(6-8-14-9-7-12)11-4-2-1-3-5-11/h1-5,10H,6-9H2