6625-04-3 Usage
Uses
Used in Pharmaceutical Industry:
(4-chlorophenyl) 2-chloropropanoate is used as an intermediate for the synthesis of various pharmaceuticals due to its unique chemical structure and reactivity. It plays a crucial role in the development of new drugs and medicines.
Used in Agrochemical Industry:
In the agrochemical sector, (4-chlorophenyl) 2-chloropropanoate is utilized as an intermediate in the production of various agrochemicals, contributing to the development of effective pest control solutions and other agricultural products.
Used in Perfumery:
(4-chlorophenyl) 2-chloropropanoate is used as a building block for the production of esters, which are widely used in the manufacturing of perfumes. Its unique chemical properties allow for the creation of diverse and complex fragrances.
Used in Flavorings:
(4-chlorophenyl) 2-chloropropanoate is also employed in the synthesis of esters for the flavoring industry, enhancing the taste and aroma of various food and beverage products.
Used in Plastics Manufacturing:
(4-chlorophenyl) 2-chloropropanoate finds application in the production of esters that are used in the manufacturing of plastics, contributing to the development of new materials with specific properties and applications.
Used in Organic Synthesis:
As a versatile building block, (4-chlorophenyl) 2-chloropropanoate is used in the synthesis of other organic compounds, expanding the range of chemicals available for various industrial and research purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 6625-04-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6625-04:
(6*6)+(5*6)+(4*2)+(3*5)+(2*0)+(1*4)=93
93 % 10 = 3
So 6625-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Cl2O2/c1-6(10)9(12)13-8-4-2-7(11)3-5-8/h2-6H,1H3
