6625-08-7 Usage
Uses
Used in Pharmaceutical Industry:
2-Hydroxy-3-methyl-4-quinolinecarboxylic acid is used as a building block for the synthesis of more complex substances, particularly in the development of pharmaceuticals. Its quinoline structure allows for the creation of new compounds with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 2-Hydroxy-3-methyl-4-quinolinecarboxylic acid serves as a valuable compound for studying the properties and reactions of quinoline derivatives. This can lead to a better understanding of their potential uses and interactions with other molecules.
Used in Material Science:
2-Hydroxy-3-methyl-4-quinolinecarboxylic acid may also find applications in material science, where its unique structure could be utilized in the development of new materials with specific properties, such as improved conductivity or stability.
Note: The specific applications mentioned above are hypothetical and based on the general properties of quinoline derivatives. The actual uses of 2-Hydroxy-3-methyl-4-quinolinecarboxylic acid may vary and depend on further research and development in the respective fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6625-08-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6625-08:
(6*6)+(5*6)+(4*2)+(3*5)+(2*0)+(1*8)=97
97 % 10 = 7
So 6625-08-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO3/c1-6-9(11(14)15)7-4-2-3-5-8(7)12-10(6)13/h2-5H,1H3,(H,12,13)(H,14,15)
