6628-90-6 Usage
Chemical structure
Contains a pyrrolidine ring with a hexynyl group and a diethylamino group attached to it.
Functional groups
Hexynyl group (reactive alkyne functional group) and diethylamino group (acts as a basic catalyst in certain reactions).
Reactivity
The hexynyl group allows for further chemical modifications, while the diethylamino group can facilitate certain reactions.
Applications
Used as a precursor in the synthesis of various pharmaceuticals and agrochemicals.
Potential uses
Has potential applications in medicinal chemistry, organic synthesis, and material science.
Versatility
Due to its unique structure and reactivity, it can be used in a wide range of chemical processes and reactions.
Molecular properties
The combination of the pyrrolidine ring, hexynyl group, and diethylamino group results in a compound with distinct molecular properties that make it valuable in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6628-90-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6628-90:
(6*6)+(5*6)+(4*2)+(3*8)+(2*9)+(1*0)=116
116 % 10 = 6
So 6628-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H26N2/c1-3-15(4-2)11-7-5-6-8-12-16-13-9-10-14-16/h3-5,7,9-14H2,1-2H3
