6628-92-8 Usage
Uses
Used in Pharmaceutical Research and Development:
9-Chloro-6,7-dimethoxy-3-nitroacridine is utilized as a building block in the synthesis of other organic compounds, particularly in the pharmaceutical industry. Its unique structure and properties make it valuable for the development of new drugs and therapeutic agents.
Used in Agrochemical Research and Development:
In the agrochemical industry, 9-chloro-6,7-dimethoxy-3-nitroacridine serves as a key component in the synthesis of various agrochemicals. Its chemical properties allow it to be used in the development of pesticides, herbicides, and other agricultural chemicals to improve crop protection and yield.
Used in Material Sciences:
9-Chloro-6,7-dimethoxy-3-nitroacridine is also employed in material sciences for the development of new materials with specific properties. Its unique structure can contribute to the creation of advanced materials with applications in various fields, such as electronics, coatings, and textiles.
Check Digit Verification of cas no
The CAS Registry Mumber 6628-92-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6628-92:
(6*6)+(5*6)+(4*2)+(3*8)+(2*9)+(1*2)=118
118 % 10 = 8
So 6628-92-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClN2O4/c1-21-13-6-10-12(7-14(13)22-2)17-11-5-8(18(19)20)3-4-9(11)15(10)16/h3-7H,1-2H3
