663193-80-4 Usage
Uses
Used in Pharmaceutical Industry:
4-Amino-5-bromo-6-chloropyrimidine is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be incorporated into the development of new drugs, potentially leading to the creation of novel therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Amino-5-bromo-6-chloropyrimidine serves as a key intermediate in the production of certain agrochemicals. Its incorporation into these products can contribute to the development of more effective and targeted pest control solutions.
Used in Dye Industry:
4-Amino-5-bromo-6-chloropyrimidine is utilized as a building block in the synthesis of dyes, particularly those with specific color properties. Its unique molecular structure allows for the creation of dyes with tailored characteristics, meeting the demands of various applications.
Used in Research and Development:
4-Amino-5-bromo-6-chloropyrimidine is also used in research and development settings, where its properties and reactivity are studied to explore new applications and understand its potential in various chemical reactions. This research can lead to the discovery of new compounds and advancements in the fields of chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 663193-80-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,3,1,9 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 663193-80:
(8*6)+(7*6)+(6*3)+(5*1)+(4*9)+(3*3)+(2*8)+(1*0)=174
174 % 10 = 4
So 663193-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrClN3/c5-2-3(6)8-1-9-4(2)7/h1H,(H2,7,8,9)
