663193-84-8 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Pyridinamine,2-bromo-5-ethoxy-(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its potential biological activity and versatile reactivity. It contributes to the development of new drugs and medicinal compounds, enhancing their therapeutic properties and effectiveness.
Used in Organic Chemistry Research:
In the field of organic chemistry, 3-Pyridinamine,2-bromo-5-ethoxy-(9CI) serves as a valuable research compound. It is utilized in the preparation of other organic compounds, facilitating the exploration of novel chemical reactions and the discovery of new synthetic pathways.
Used in Medicinal Chemistry and Drug Development:
3-Pyridinamine,2-bromo-5-ethoxy-(9CI) plays a significant role in medicinal chemistry and drug development. Its unique structure and reactivity make it a promising candidate for the design and synthesis of new therapeutic agents, targeting various diseases and medical conditions.
Overall, 3-Pyridinamine, 2-bromo-5-ethoxy (9CI) is an important chemical with potential utility in various areas of chemistry and biochemistry, including pharmaceutical synthesis, organic chemistry research, and medicinal chemistry and drug development. Its versatile reactivity and potential biological activity contribute to the advancement of new drug discoveries and the understanding of chemical reactions in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 663193-84-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,3,1,9 and 3 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 663193-84:
(8*6)+(7*6)+(6*3)+(5*1)+(4*9)+(3*3)+(2*8)+(1*4)=178
178 % 10 = 8
So 663193-84-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9BrN2O/c1-2-11-5-3-6(9)7(8)10-4-5/h3-4H,2,9H2,1H3
