6633-60-9 Usage
General Description
(2,4-dichlorophenyl) thiophene-2-carboxylate is a kind of chemical compound used in various industrial and pharmaceutical applications. It is a derivative of thiophene, a five-membered ring containing four carbon atoms and one sulfur atom. The presence of a carboxylate group in the compound makes it suitable for use in the manufacturing of pharmaceuticals and agricultural products. Additionally, the dichlorophenyl group adds to its versatility, as it can be used as a building block in the synthesis of other organic compounds. Overall, this compound has a wide range of potential uses in various fields, making it a valuable chemical in the industry.
Check Digit Verification of cas no
The CAS Registry Mumber 6633-60-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6633-60:
(6*6)+(5*6)+(4*3)+(3*3)+(2*6)+(1*0)=99
99 % 10 = 9
So 6633-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H9BrClF2NO2/c15-8-1-4-13(10(16)5-8)21-7-14(20)19-12-3-2-9(17)6-11(12)18/h1-6H,7H2,(H,19,20)
