6633-60-9 Usage
Description
(2,4-dichlorophenyl) thiophene-2-carboxylate is a chemical compound derived from thiophene, featuring a five-membered ring with four carbon atoms and one sulfur atom, along with a carboxylate group and a dichlorophenyl group. This structure endows it with a broad range of applications in various industries, particularly in pharmaceuticals and agriculture, due to its unique properties and versatility in the synthesis of other organic compounds.
Uses
Used in Pharmaceutical Industry:
(2,4-dichlorophenyl) thiophene-2-carboxylate is used as an intermediate in the synthesis of pharmaceuticals for its potential therapeutic properties and ability to be incorporated into various drug molecules.
Used in Agricultural Industry:
In agriculture, (2,4-dichlorophenyl) thiophene-2-carboxylate is used as a building block in the development of agrochemicals, such as pesticides and herbicides, due to its chemical structure that can be tailored for specific applications.
Used in Organic Synthesis:
(2,4-dichlorophenyl) thiophene-2-carboxylate is utilized as a versatile building block in organic synthesis, allowing for the creation of a wide array of organic compounds for various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6633-60-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6633-60:
(6*6)+(5*6)+(4*3)+(3*3)+(2*6)+(1*0)=99
99 % 10 = 9
So 6633-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H9BrClF2NO2/c15-8-1-4-13(10(16)5-8)21-7-14(20)19-12-3-2-9(17)6-11(12)18/h1-6H,7H2,(H,19,20)