6635-26-3 Usage
General Description
2,3-Dihydro-1H-cyclopenta[b]quinoxaline-1,3-dicarboxylic acid=diethyl is a chemical compound with the molecular formula C18H20N2O4. It is classified as a diethyl ester and is commonly used in the production of pharmaceuticals and agrochemicals. This chemical is known for its potential biological and pharmacological activities, making it a valuable compound in the field of medicinal chemistry. Its unique structure and properties make it an important ingredient in the development of new drugs and treatments. Additionally, 2,3-Dihydro-1H-cyclopenta[b]quinoxaline-1,3-dicarboxylic acid=diethyl is also used in various research applications due to its potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 6635-26-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 5 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6635-26:
(6*6)+(5*6)+(4*3)+(3*5)+(2*2)+(1*6)=103
103 % 10 = 3
So 6635-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H18N2O4/c1-3-22-16(20)10-9-11(17(21)23-4-2)15-14(10)18-12-7-5-6-8-13(12)19-15/h5-8,10-11H,3-4,9H2,1-2H3