663955-79-1 Usage
General Description
5-Bromo-2-(4-methoxybenzyloxy)pyridine is a synthetic, organic compound that belongs to the class of chemicals known as organic halogen compounds. It comprises a halogenated pyridine ring, specifically bromine, attached to a methoxybenzyloxy methoxy group at the second position of the pyridine ring. 5-Bromo-2-(4-methoxybenzyloxy)pyridine is known for its role in chemical synthesis, typically serving as a versatile intermediate in the field of organic chemistry for the production of more complex molecules. Its potential applications could extend across various fields such as pharmaceuticals, agrochemicals, and materials science. The specifics of its use rely on the exact synthesis pathways and target molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 663955-79-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,3,9,5 and 5 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 663955-79:
(8*6)+(7*6)+(6*3)+(5*9)+(4*5)+(3*5)+(2*7)+(1*9)=211
211 % 10 = 1
So 663955-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H12BrNO2/c1-16-12-5-2-10(3-6-12)9-17-13-7-4-11(14)8-15-13/h2-8H,9H2,1H3
663955-79-1Relevant articles and documents
CHEMICAL COMPOUNDS
-
Page/Page column 72, (2010/11/08)
This invention relates to non-steroidal compounds that are modulators of androgen, glucocorticoid, mineralocorticoid, and progesterone receptors, and also to the methods for the making and use of such compounds.
