664-24-4 Usage
Uses
Used in Pharmaceutical Industry:
Acrifoline is used as a pharmaceutical compound for its potential therapeutic effects. Its unique chemical structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs. The alkaloid nature of Acrifoline suggests that it may have applications in treating various diseases and conditions.
Used in Chemical Research:
Acrifoline is used as a research compound for studying the properties and behavior of quinolizidine alkaloids. Its unique structure makes it an interesting subject for chemical investigations, which can lead to a better understanding of the properties and potential applications of similar compounds.
Used in Natural Products:
Acrifoline, being a natural alkaloid, can be used in the development of natural products, such as dietary supplements or cosmetics. Its potential health benefits and unique properties may make it a valuable ingredient in these products.
Used in Drug Delivery Systems:
Similar to gallotannin, Acrifoline could be employed in drug delivery systems to improve its bioavailability and therapeutic outcomes. By incorporating Acrifoline into various carriers, such as organic or metallic nanoparticles, its delivery and efficacy against specific targets can be enhanced.
Check Digit Verification of cas no
The CAS Registry Mumber 664-24-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,6 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 664-24:
(5*6)+(4*6)+(3*4)+(2*2)+(1*4)=74
74 % 10 = 4
So 664-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H23NO2/c1-10-9-16-12-4-2-6-17(16)7-3-5-13(16)14(18)8-11(12)15(10)19/h4,10-11,13-14,18H,2-3,5-9H2,1H3/t10-,11-,13-,14-,16+/m1/s1
